
structural formula
| business number | 01dy |
|---|---|
| molecular formula | c7h13no3s |
| molecular weight | 191.25 |
| label |
n-acetyl l-methionine, ch3sch2ch2ch(nhcoch3)co2h |
numbering system
cas number:65-82-7
mdl number:mfcd00064441
einecs number:200-617-7
rtecs number:pd0480000
brn number:1725552
pubchem number:24845156
physical property data
1. character:colorless or glossy white crystals or white powder. odorless or nearly odorless
2. density (g/ml,25/4℃): unsure
3. relative vapor density (g/ml,air=1): unsure
4. melting point (ºc):103 -106
5. boiling point (ºc,normal pressure): uncertain
6. boiling point (ºc, 5.2kpa): unsure
7. refractive index:-21 ° (c=1, h2o)
8. flash point (ºc): unsure
9. specific optical rotation (º):-20 º (c=4 h2o)
10. autoignition point or ignition temperature (ºc): unsure
11. vapor pressure (kpa,25ºc): unsure
12. 17. explosion upper limit (%,v/v): unsure
18. lower explosion limit (%,v/v): unsure
19. solubility:soluble in water, ethanol, alkaline solution and dilute inorganic acid, almost insoluble in ether
toxicological data
acute toxicity: mouse intravenous ld50: 435 mg/kg;
ecological data
none yet
molecular structure data
1. molar refractive index:47.62
2. molar volume (m3/mol):158.9
3. isotonic specific volume (90.2k):413.5
4. surface tension (dyne/cm):45.7
5. polarizability(10-24cm3):18.87
compute chemical data
1. reference value for hydrophobic parameter calculation (xlogp): none
2. number of hydrogen bond donors: 2
3. number of hydrogen bond acceptors: 4
4. number of rotatable chemical bonds: 5
5. number of tautomers: 2
6. topological molecule polar surface area 91.7
7. number of heavy atoms: 12
8. surface charge: 0
9. complexity: 172
10. number of isotope atoms: 0
11. determine the number of atomic stereocenters: 1
12. uncertain number of atomic stereocenters: 0
13. determine the number of chemical bond stereocenters: 0
14. number of uncertain chemical bond stereocenters: 0
15. number of covalent bond units: 1
properties and stability
none yet
storage method
byl-methionine is acetylated with excess acetic acid or acetic anhydride .
synthesis method
none yet
purpose
nutritional supplements.
” align=left> 3. isotonic specific volume (90.2k):413.5
4. surface tension (dyne/cm):45.7
5. polarizability(10-24cm3):18.87
compute chemical data
1. reference value for hydrophobic parameter calculation (xlogp): none
2. number of hydrogen bond donors: 2
3. number of hydrogen bond acceptors: 4
4. number of rotatable chemical bonds: 5
5. number of tautomers: 2
6. topological molecule polar surface area 91.7
7. number of heavy atoms: 12
8. surface charge: 0
9. complexity: 172
10. number of isotope atoms: 0
11. determine the number of atomic stereocenters: 1
12. uncertain number of atomic stereocenters: 0
13. determine the number of chemical bond stereocenters: 0
14. number of uncertain chemical bond stereocenters: 0
15. number of covalent bond units: 1
properties and stability
none yet
storage method
byl-methionine is acetylated with excess acetic acid or acetic anhydride .
synthesis method
none yet
purpose
nutritional supplements.

微信扫一扫打赏
